C11H16FNO3S — CID 115048817
4-(3-fluoro-1-isocyanato-3-methylcyclobutyl)thiane 1,1-dioxide (PubChem CID 115048817) has the molecular formula C11H16FNO3S and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-(3-fluoro-1-isocyanato-3-methylcyclobutyl)thiane 1,1-dioxide.
| Compound Name | 4-(3-fluoro-1-isocyanato-3-methylcyclobutyl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 115048817 |
| Molecular Formula | C11H16FNO3S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-(3-fluoro-1-isocyanato-3-methylcyclobutyl)thiane 1,1-dioxide |
| SMILES | CC1(F)CC(N=C=O)(C2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C11H16FNO3S/c1-10(12)6-11(7-10,13-8-14)9-2-4-17(15,16)5-3-9/h9H,2-7H2,1H3 |
| InChIKey | HBQQTQXUFYBCSA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|