C9H17NO2S — CID 84671818
1-(1,1-dioxothian-4-yl)-N-methylcyclopropan-1-amine (PubChem CID 84671818) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-N-methylcyclopropan-1-amine.
| Compound Name | 1-(1,1-dioxothian-4-yl)-N-methylcyclopropan-1-amine |
|---|---|
| PubChem CID | 84671818 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-N-methylcyclopropan-1-amine |
| SMILES | CNC1(C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C9H17NO2S/c1-10-9(4-5-9)8-2-6-13(11,12)7-3-8/h8,10H,2-7H2,1H3 |
| InChIKey | RHZSLSNXQUMMSI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |