C9H15NO4S — CID 105492913
4-(1,1-dioxothian-4-yl)-4-methyl-1,3-oxazolidin-2-one (PubChem CID 105492913) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is 4-(1,1-dioxothian-4-yl)-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | 4-(1,1-dioxothian-4-yl)-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 105492913 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4-(1,1-dioxothian-4-yl)-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C2CCS(=O)(=O)CC2)COC(=O)N1 |
| InChI | InChI=1S/C9H15NO4S/c1-9(6-14-8(11)10-9)7-2-4-15(12,13)5-3-7/h7H,2-6H2,1H3,(H,10,11) |
| InChIKey | MZSRQDDCMMFJFI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |