C5H9NO3 — CID 19933761
4-ethyl-4-hydroxy-1,3-oxazolidin-2-one (PubChem CID 19933761) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is 4-ethyl-4-hydroxy-1,3-oxazolidin-2-one.
| Compound Name | 4-ethyl-4-hydroxy-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 19933761 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 4-ethyl-4-hydroxy-1,3-oxazolidin-2-one |
| SMILES | CCC1(O)COC(=O)N1 |
| InChI | InChI=1S/C5H9NO3/c1-2-5(8)3-9-4(7)6-5/h8H,2-3H2,1H3,(H,6,7) |
| InChIKey | WAIIHWSIUNWYRT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |