About 3-ethyl-2H-1,4-benzodioxin-3-ol
3-ethyl-2H-1,4-benzodioxin-3-ol (PubChem CID 13487110) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-ethyl-2H-1,4-benzodioxin-3-ol.
Molecular Properties
| Compound Name | 3-ethyl-2H-1,4-benzodioxin-3-ol |
| PubChem CID | 13487110 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-ethyl-2H-1,4-benzodioxin-3-ol |
| SMILES | CCC1(O)COc2ccccc2O1 |
| InChI | InChI=1S/C10H12O3/c1-2-10(11)7-12-8-5-3-4-6-9(8)13-10/h3-6,11H,2,7H2,1H3 |
| InChIKey | FXKFSCRKFRCJKD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-2H-1,4-benzodioxin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2H-1,4-benzodioxin-3-ol?
The IUPAC name of 3-ethyl-2H-1,4-benzodioxin-3-ol (CID 13487110) is 3-ethyl-2H-1,4-benzodioxin-3-ol.
What is the SMILES notation for 3-ethyl-2H-1,4-benzodioxin-3-ol?
The canonical SMILES for 3-ethyl-2H-1,4-benzodioxin-3-ol is CCC1(O)COc2ccccc2O1.
What is the InChIKey of 3-ethyl-2H-1,4-benzodioxin-3-ol?
The InChIKey is FXKFSCRKFRCJKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-2-10(11)7-12-8-5-3-4-6-9(8)13-10/h3-6,11H,2,7H2,1H3.
What are the key properties of 3-ethyl-2H-1,4-benzodioxin-3-ol?
3-ethyl-2H-1,4-benzodioxin-3-ol has a molecular weight of 180.20 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2H-1,4-benzodioxin-3-ol is sourced from PubChem (CID 13487110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).