C16H24O3 — CID 124674979
[(3S)-3-heptyl-2H-1,4-benzodioxin-3-yl]methanol (PubChem CID 124674979) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is [(3S)-3-heptyl-2H-1,4-benzodioxin-3-yl]methanol.
| Compound Name | [(3S)-3-heptyl-2H-1,4-benzodioxin-3-yl]methanol |
|---|---|
| PubChem CID | 124674979 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [(3S)-3-heptyl-2H-1,4-benzodioxin-3-yl]methanol |
| SMILES | CCCCCCC[C@]1(CO)COc2ccccc2O1 |
| InChI | InChI=1S/C16H24O3/c1-2-3-4-5-8-11-16(12-17)13-18-14-9-6-7-10-15(14)19-16/h6-7,9-10,17H,2-5,8,11-13H2,1H3/t16-/m0/s1 |
| InChIKey | JYBXFZOIOIYHHK-INIZCTEOSA-N |
| XLogP | 3.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|