C18H26BrNO — CID 135063902
(5R)-5-(bromomethyl)-5-octyl-2-phenyl-4H-1,3-oxazole (PubChem CID 135063902) has the molecular formula C18H26BrNO and a molecular weight of 352.32 g/mol. Its IUPAC name is (5R)-5-(bromomethyl)-5-octyl-2-phenyl-4H-1,3-oxazole.
| Compound Name | (5R)-5-(bromomethyl)-5-octyl-2-phenyl-4H-1,3-oxazole |
|---|---|
| PubChem CID | 135063902 |
| Molecular Formula | C18H26BrNO |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (5R)-5-(bromomethyl)-5-octyl-2-phenyl-4H-1,3-oxazole |
| SMILES | CCCCCCCC[C@]1(CBr)CN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C18H26BrNO/c1-2-3-4-5-6-10-13-18(14-19)15-20-17(21-18)16-11-8-7-9-12-16/h7-9,11-12H,2-6,10,13-15H2,1H3/t18-/m0/s1 |
| InChIKey | WYKDUUDZNWJSTL-SFHVURJKSA-N |
| XLogP | 5.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|