C19H25Br — CID 124637051
(5S)-5-bromo-5-heptyl-2-phenylcyclohexa-1,3-diene (PubChem CID 124637051) has the molecular formula C19H25Br and a molecular weight of 333.31 g/mol. Its IUPAC name is (5S)-5-bromo-5-heptyl-2-phenylcyclohexa-1,3-diene.
| Compound Name | (5S)-5-bromo-5-heptyl-2-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 124637051 |
| Molecular Formula | C19H25Br |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (5S)-5-bromo-5-heptyl-2-phenylcyclohexa-1,3-diene |
| SMILES | CCCCCCC[C@@]1(Br)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C19H25Br/c1-2-3-4-5-9-14-19(20)15-12-18(13-16-19)17-10-7-6-8-11-17/h6-8,10-13,15H,2-5,9,14,16H2,1H3/t19-/m1/s1 |
| InChIKey | XTUMBVHOCZFGKT-LJQANCHMSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|