C18H23BrO — CID 174534699
5-bromo-5-hexoxy-2-phenylcyclohexa-1,3-diene (PubChem CID 174534699) has the molecular formula C18H23BrO and a molecular weight of 335.28 g/mol. Its IUPAC name is 5-bromo-5-hexoxy-2-phenylcyclohexa-1,3-diene.
| Compound Name | 5-bromo-5-hexoxy-2-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 174534699 |
| Molecular Formula | C18H23BrO |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 5-bromo-5-hexoxy-2-phenylcyclohexa-1,3-diene |
| SMILES | CCCCCCOC1(Br)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C18H23BrO/c1-2-3-4-8-15-20-18(19)13-11-17(12-14-18)16-9-6-5-7-10-16/h5-7,9-13H,2-4,8,14-15H2,1H3 |
| InChIKey | IJQFNMUIHFWJGB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|