C22H26N2O — CID 70563537
4-(4-cyano-4-octoxycyclohexa-1,5-dien-1-yl)benzonitrile (PubChem CID 70563537) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-(4-cyano-4-octoxycyclohexa-1,5-dien-1-yl)benzonitrile.
| Compound Name | 4-(4-cyano-4-octoxycyclohexa-1,5-dien-1-yl)benzonitrile |
|---|---|
| PubChem CID | 70563537 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 4-(4-cyano-4-octoxycyclohexa-1,5-dien-1-yl)benzonitrile |
| SMILES | CCCCCCCCOC1(C#N)C=CC(c2ccc(C#N)cc2)=CC1 |
| InChI | InChI=1S/C22H26N2O/c1-2-3-4-5-6-7-16-25-22(18-24)14-12-21(13-15-22)20-10-8-19(17-23)9-11-20/h8-14H,2-7,15-16H2,1H3 |
| InChIKey | UJRQVSDIDAATSX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|