C23H30N4O2 — CID 70034284
1-[3-[4-[2-(methylamino)acetyl]piperazin-1-yl]propoxy]-4-phenylcyclohexa-2,4-diene-1-carbonitrile (PubChem CID 70034284) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[3-[4-[2-(methylamino)acetyl]piperazin-1-yl]propoxy]-4-phenylcyclohexa-2,4-diene-1-carbonitrile.
| Compound Name | 1-[3-[4-[2-(methylamino)acetyl]piperazin-1-yl]propoxy]-4-phenylcyclohexa-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 70034284 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-[3-[4-[2-(methylamino)acetyl]piperazin-1-yl]propoxy]-4-phenylcyclohexa-2,4-diene-1-carbonitrile |
| SMILES | CNCC(=O)N1CCN(CCCOC2(C#N)C=CC(c3ccccc3)=CC2)CC1 |
| InChI | InChI=1S/C23H30N4O2/c1-25-18-22(28)27-15-13-26(14-16-27)12-5-17-29-23(19-24)10-8-21(9-11-23)20-6-3-2-4-7-20/h2-4,6-10,25H,5,11-18H2,1H3 |
| InChIKey | XSEYVKVSUIEWFA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|