C53H60N2O2 — CID 175573145
1-heptoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile;1-octoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile (PubChem CID 175573145) has the molecular formula C53H60N2O2 and a molecular weight of 757.08 g/mol. Its IUPAC name is 1-heptoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile;1-octoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile.
| Compound Name | 1-heptoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile;1-octoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 175573145 |
| Molecular Formula | C53H60N2O2 |
| Molecular Weight | 757.08 g/mol |
| Exact Mass | 756.47 |
| IUPAC Name | 1-heptoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile;1-octoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile |
| SMILES | CCCCCCCCOC1(C#N)C=CC(c2ccc(-c3ccccc3)cc2)=CC1.CCCCCCCOC1(C#N)C=CC(c2ccc(-c3ccccc3)cc2)=CC1 |
| InChI | InChI=1S/C27H31NO.C26H29NO/c1-2-3-4-5-6-10-21-29-27(22-28)19-17-26(18-20-27)25-15-13-24(14-16-25)23-11-8-7-9-12-23;1-2-3-4-5-9-20-28-26(21-27)18-16-25(17-19-26)24-14-12-23(13-15-24)22-10-7-6-8-11-22/h7-9,11-19H,2-6,10,20-21H2,1H3;6-8,10-18H,2-5,9,19-20H2,1H3 |
| InChIKey | OXHKEOIEWBRDFY-UHFFFAOYSA-N |
| XLogP | 14.28 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.08 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|