C29H41NO — CID 70406866
1-[2-(1-heptoxy-4-phenylcyclohexa-2,4-dien-1-yl)ethyl]-3-methylcyclohexane-1-carbonitrile (PubChem CID 70406866) has the molecular formula C29H41NO and a molecular weight of 419.65 g/mol. Its IUPAC name is 1-[2-(1-heptoxy-4-phenylcyclohexa-2,4-dien-1-yl)ethyl]-3-methylcyclohexane-1-carbonitrile.
| Compound Name | 1-[2-(1-heptoxy-4-phenylcyclohexa-2,4-dien-1-yl)ethyl]-3-methylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 70406866 |
| Molecular Formula | C29H41NO |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.32 |
| IUPAC Name | 1-[2-(1-heptoxy-4-phenylcyclohexa-2,4-dien-1-yl)ethyl]-3-methylcyclohexane-1-carbonitrile |
| SMILES | CCCCCCCOC1(CCC2(C#N)CCCC(C)C2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C29H41NO/c1-3-4-5-6-10-22-31-29(21-20-28(24-30)17-11-12-25(2)23-28)18-15-27(16-19-29)26-13-8-7-9-14-26/h7-9,13-16,18,25H,3-6,10-12,17,19-23H2,1-2H3 |
| InChIKey | OZVHBWURVAGWAJ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|