C25H27NO — CID 175508488
1-hexoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile (PubChem CID 175508488) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-hexoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile.
| Compound Name | 1-hexoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 175508488 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-hexoxy-4-(4-phenylphenyl)cyclohexa-2,4-diene-1-carbonitrile |
| SMILES | CCCCCCOC1(C#N)C=CC(c2ccc(-c3ccccc3)cc2)=CC1 |
| InChI | InChI=1S/C25H27NO/c1-2-3-4-8-19-27-25(20-26)17-15-24(16-18-25)23-13-11-22(12-14-23)21-9-6-5-7-10-21/h5-7,9-17H,2-4,8,18-19H2,1H3 |
| InChIKey | GDQJYHPVTFNSGH-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|