C17H23BO3 — CID 174951146
(1-pentoxy-4-phenylcyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 174951146) has the molecular formula C17H23BO3 and a molecular weight of 286.18 g/mol. Its IUPAC name is (1-pentoxy-4-phenylcyclohexa-2,4-dien-1-yl)boronic acid.
| Compound Name | (1-pentoxy-4-phenylcyclohexa-2,4-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 174951146 |
| Molecular Formula | C17H23BO3 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1-pentoxy-4-phenylcyclohexa-2,4-dien-1-yl)boronic acid |
| SMILES | CCCCCOC1(B(O)O)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C17H23BO3/c1-2-3-7-14-21-17(18(19)20)12-10-16(11-13-17)15-8-5-4-6-9-15/h4-6,8-12,19-20H,2-3,7,13-14H2,1H3 |
| InChIKey | CJAFTDWYHZYUCU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|