C16H19Br — CID 169095921
5-bromo-5-butyl-2-phenylcyclohexa-1,3-diene (PubChem CID 169095921) has the molecular formula C16H19Br and a molecular weight of 291.23 g/mol. Its IUPAC name is 5-bromo-5-butyl-2-phenylcyclohexa-1,3-diene.
| Compound Name | 5-bromo-5-butyl-2-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 169095921 |
| Molecular Formula | C16H19Br |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-bromo-5-butyl-2-phenylcyclohexa-1,3-diene |
| SMILES | CCCCC1(Br)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C16H19Br/c1-2-3-11-16(17)12-9-15(10-13-16)14-7-5-4-6-8-14/h4-10,12H,2-3,11,13H2,1H3 |
| InChIKey | GLSIVDIIMUOACK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|