About 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol
1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol (PubChem CID 175269235) has the molecular formula C18H24O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol |
| PubChem CID | 175269235 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol |
| SMILES | CCCC1(C(O)C(C)O)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C18H24O2/c1-3-11-18(17(20)14(2)19)12-9-16(10-13-18)15-7-5-4-6-8-15/h4-10,12,14,17,19-20H,3,11,13H2,1-2H3 |
| InChIKey | QGIREKNXGLSOSG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol?
The IUPAC name of 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol (CID 175269235) is 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol.
What is the SMILES notation for 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol?
The canonical SMILES for 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol is CCCC1(C(O)C(C)O)C=CC(c2ccccc2)=CC1.
What is the InChIKey of 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol?
The InChIKey is QGIREKNXGLSOSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O2/c1-3-11-18(17(20)14(2)19)12-9-16(10-13-18)15-7-5-4-6-8-15/h4-10,12,14,17,19-20H,3,11,13H2,1-2H3.
What are the key properties of 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol?
1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol has a molecular weight of 272.39 g/mol, XLogP of 3.56, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-phenyl-1-propylcyclohexa-2,4-dien-1-yl)propane-1,2-diol is sourced from PubChem (CID 175269235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).