C19H23NS — CID 175066063
5-hexyl-5-isothiocyanato-2-phenylcyclohexa-1,3-diene (PubChem CID 175066063) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is 5-hexyl-5-isothiocyanato-2-phenylcyclohexa-1,3-diene.
| Compound Name | 5-hexyl-5-isothiocyanato-2-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175066063 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 5-hexyl-5-isothiocyanato-2-phenylcyclohexa-1,3-diene |
| SMILES | CCCCCCC1(N=C=S)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C19H23NS/c1-2-3-4-8-13-19(20-16-21)14-11-18(12-15-19)17-9-6-5-7-10-17/h5-7,9-12,14H,2-4,8,13,15H2,1H3 |
| InChIKey | ZUKBWOKBMRLWDL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|