C27H33NO2 — CID 70192845
3-[1-(5-heptyl-2-pyridinyl)-4-phenylcyclohexa-2,4-dien-1-yl]propanoic acid (PubChem CID 70192845) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 3-[1-(5-heptyl-2-pyridinyl)-4-phenylcyclohexa-2,4-dien-1-yl]propanoic acid.
| Compound Name | 3-[1-(5-heptyl-2-pyridinyl)-4-phenylcyclohexa-2,4-dien-1-yl]propanoic acid |
|---|---|
| PubChem CID | 70192845 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 3-[1-(5-heptyl-2-pyridinyl)-4-phenylcyclohexa-2,4-dien-1-yl]propanoic acid |
| SMILES | CCCCCCCc1ccc(C2(CCC(=O)O)C=CC(c3ccccc3)=CC2)nc1 |
| InChI | InChI=1S/C27H33NO2/c1-2-3-4-5-7-10-22-13-14-25(28-21-22)27(20-17-26(29)30)18-15-24(16-19-27)23-11-8-6-9-12-23/h6,8-9,11-16,18,21H,2-5,7,10,17,19-20H2,1H3,(H,29,30) |
| InChIKey | XSHRIZKMCHWTBP-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|