C32H40O3 — CID 67939752
[1-(4-butylphenyl)-1-oxopropan-2-yl] 1-hexyl-4-phenylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 67939752) has the molecular formula C32H40O3 and a molecular weight of 472.67 g/mol. Its IUPAC name is [1-(4-butylphenyl)-1-oxopropan-2-yl] 1-hexyl-4-phenylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | [1-(4-butylphenyl)-1-oxopropan-2-yl] 1-hexyl-4-phenylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 67939752 |
| Molecular Formula | C32H40O3 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | [1-(4-butylphenyl)-1-oxopropan-2-yl] 1-hexyl-4-phenylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCCCCCC1(C(=O)OC(C)C(=O)c2ccc(CCCC)cc2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C32H40O3/c1-4-6-8-12-22-32(23-20-28(21-24-32)27-14-10-9-11-15-27)31(34)35-25(3)30(33)29-18-16-26(17-19-29)13-7-5-2/h9-11,14-21,23,25H,4-8,12-13,22,24H2,1-3H3 |
| InChIKey | VSLRPALGFBBECG-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|