C24H26O2 — CID 175244002
phenyl 1-(2-methylbutyl)-4-phenylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 175244002) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is phenyl 1-(2-methylbutyl)-4-phenylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | phenyl 1-(2-methylbutyl)-4-phenylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 175244002 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | phenyl 1-(2-methylbutyl)-4-phenylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCC(C)CC1(C(=O)Oc2ccccc2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C24H26O2/c1-3-19(2)18-24(23(25)26-22-12-8-5-9-13-22)16-14-21(15-17-24)20-10-6-4-7-11-20/h4-16,19H,3,17-18H2,1-2H3 |
| InChIKey | LUXOZMFUNFJQMR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|