C26H20O4 — CID 69344800
diphenyl 4-phenylcyclohexa-2,4-diene-1,1-dicarboxylate (PubChem CID 69344800) has the molecular formula C26H20O4 and a molecular weight of 396.44 g/mol. Its IUPAC name is diphenyl 4-phenylcyclohexa-2,4-diene-1,1-dicarboxylate.
| Compound Name | diphenyl 4-phenylcyclohexa-2,4-diene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 69344800 |
| Molecular Formula | C26H20O4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | diphenyl 4-phenylcyclohexa-2,4-diene-1,1-dicarboxylate |
| SMILES | O=C(Oc1ccccc1)C1(C(=O)Oc2ccccc2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C26H20O4/c27-24(29-22-12-6-2-7-13-22)26(25(28)30-23-14-8-3-9-15-23)18-16-21(17-19-26)20-10-4-1-5-11-20/h1-18H,19H2 |
| InChIKey | JNJCHCKUFLMSEZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|