C26H18F2O2 — CID 162720571
[1-(4-fluorobenzoyl)-4-phenylcyclohexa-2,4-dien-1-yl]-(4-fluorophenyl)methanone (PubChem CID 162720571) has the molecular formula C26H18F2O2 and a molecular weight of 400.42 g/mol. Its IUPAC name is [1-(4-fluorobenzoyl)-4-phenylcyclohexa-2,4-dien-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-(4-fluorobenzoyl)-4-phenylcyclohexa-2,4-dien-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 162720571 |
| Molecular Formula | C26H18F2O2 |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [1-(4-fluorobenzoyl)-4-phenylcyclohexa-2,4-dien-1-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)C1(C(=O)c2ccc(F)cc2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C26H18F2O2/c27-22-10-6-20(7-11-22)24(29)26(25(30)21-8-12-23(28)13-9-21)16-14-19(15-17-26)18-4-2-1-3-5-18/h1-16H,17H2 |
| InChIKey | MJXMIEJIGZZJTL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|