C24H30N2O2 — CID 154003209
1-N',1-N'-dicyclopentyl-4-phenylcyclohexa-2,4-diene-1,1-dicarboxamide (PubChem CID 154003209) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-N',1-N'-dicyclopentyl-4-phenylcyclohexa-2,4-diene-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-dicyclopentyl-4-phenylcyclohexa-2,4-diene-1,1-dicarboxamide |
|---|---|
| PubChem CID | 154003209 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-N',1-N'-dicyclopentyl-4-phenylcyclohexa-2,4-diene-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N(C2CCCC2)C2CCCC2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C24H30N2O2/c25-22(27)24(16-14-19(15-17-24)18-8-2-1-3-9-18)23(28)26(20-10-4-5-11-20)21-12-6-7-13-21/h1-3,8-9,14-16,20-21H,4-7,10-13,17H2,(H2,25,27) |
| InChIKey | ORRUXHNPIGEERB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|