About 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid
2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid (PubChem CID 174854595) has the molecular formula C15H16ClNO2
and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid |
| PubChem CID | 174854595 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid |
| SMILES | NC(CC1(Cl)C=CC(c2ccccc2)=CC1)C(=O)O |
| InChI | InChI=1S/C15H16ClNO2/c16-15(10-13(17)14(18)19)8-6-12(7-9-15)11-4-2-1-3-5-11/h1-8,13H,9-10,17H2,(H,18,19) |
| InChIKey | DVEPIRIKONAEFR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid?
The IUPAC name of 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid (CID 174854595) is 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid is NC(CC1(Cl)C=CC(c2ccccc2)=CC1)C(=O)O.
What is the InChIKey of 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid?
The InChIKey is DVEPIRIKONAEFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO2/c16-15(10-13(17)14(18)19)8-6-12(7-9-15)11-4-2-1-3-5-11/h1-8,13H,9-10,17H2,(H,18,19).
What are the key properties of 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid?
2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid has a molecular weight of 277.75 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1-chloro-4-phenylcyclohexa-2,4-dien-1-yl)propanoic acid is sourced from PubChem (CID 174854595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).