C17H18BrClO — CID 70094254
1-(1-bromo-4-phenylcyclohexa-2,4-dien-1-yl)-5-chloropentan-1-one (PubChem CID 70094254) has the molecular formula C17H18BrClO and a molecular weight of 353.69 g/mol. Its IUPAC name is 1-(1-bromo-4-phenylcyclohexa-2,4-dien-1-yl)-5-chloropentan-1-one.
| Compound Name | 1-(1-bromo-4-phenylcyclohexa-2,4-dien-1-yl)-5-chloropentan-1-one |
|---|---|
| PubChem CID | 70094254 |
| Molecular Formula | C17H18BrClO |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 1-(1-bromo-4-phenylcyclohexa-2,4-dien-1-yl)-5-chloropentan-1-one |
| SMILES | O=C(CCCCCl)C1(Br)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C17H18BrClO/c18-17(16(20)8-4-5-13-19)11-9-15(10-12-17)14-6-2-1-3-7-14/h1-3,6-7,9-11H,4-5,8,12-13H2 |
| InChIKey | USGZWYANNUGNNW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|