C12H10Cl2O2S — CID 87321478
1-chloro-4-phenylcyclohexa-2,4-diene-1-sulfonyl chloride (PubChem CID 87321478) has the molecular formula C12H10Cl2O2S and a molecular weight of 289.18 g/mol. Its IUPAC name is 1-chloro-4-phenylcyclohexa-2,4-diene-1-sulfonyl chloride.
| Compound Name | 1-chloro-4-phenylcyclohexa-2,4-diene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 87321478 |
| Molecular Formula | C12H10Cl2O2S |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 1-chloro-4-phenylcyclohexa-2,4-diene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C1(Cl)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C12H10Cl2O2S/c13-12(17(14,15)16)8-6-11(7-9-12)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | HQYZAMLWTPYJKA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|