C14H17NO2S — CID 175218489
N,1-dimethyl-4-phenylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 175218489) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is N,1-dimethyl-4-phenylcyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | N,1-dimethyl-4-phenylcyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 175218489 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | N,1-dimethyl-4-phenylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CNS(=O)(=O)C1(C)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C14H17NO2S/c1-14(18(16,17)15-2)10-8-13(9-11-14)12-6-4-3-5-7-12/h3-10,15H,11H2,1-2H3 |
| InChIKey | XBLOESLDLVQMGF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |