C19H23NO2S — CID 175441698
1-ethynyl-N-(3-methylbutyl)-4-phenylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 175441698) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-ethynyl-N-(3-methylbutyl)-4-phenylcyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | 1-ethynyl-N-(3-methylbutyl)-4-phenylcyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 175441698 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-ethynyl-N-(3-methylbutyl)-4-phenylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | C#CC1(S(=O)(=O)NCCC(C)C)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C19H23NO2S/c1-4-19(23(21,22)20-15-12-16(2)3)13-10-18(11-14-19)17-8-6-5-7-9-17/h1,5-11,13,16,20H,12,14-15H2,2-3H3 |
| InChIKey | LJGQDACPSWFQPW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|