C28H20O12S2 — CID 88525884
4-[1-(3,4-dicarboxyphenyl)sulfonyl-4-phenylcyclohexa-2,4-dien-1-yl]sulfonylphthalic acid (PubChem CID 88525884) has the molecular formula C28H20O12S2 and a molecular weight of 612.59 g/mol. Its IUPAC name is 4-[1-(3,4-dicarboxyphenyl)sulfonyl-4-phenylcyclohexa-2,4-dien-1-yl]sulfonylphthalic acid.
| Compound Name | 4-[1-(3,4-dicarboxyphenyl)sulfonyl-4-phenylcyclohexa-2,4-dien-1-yl]sulfonylphthalic acid |
|---|---|
| PubChem CID | 88525884 |
| Molecular Formula | C28H20O12S2 |
| Molecular Weight | 612.59 g/mol |
| Exact Mass | 612.04 |
| IUPAC Name | 4-[1-(3,4-dicarboxyphenyl)sulfonyl-4-phenylcyclohexa-2,4-dien-1-yl]sulfonylphthalic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)C2(S(=O)(=O)c3ccc(C(=O)O)c(C(=O)O)c3)C=CC(c3ccccc3)=CC2)cc1C(=O)O |
| InChI | InChI=1S/C28H20O12S2/c29-24(30)20-8-6-18(14-22(20)26(33)34)41(37,38)28(12-10-17(11-13-28)16-4-2-1-3-5-16)42(39,40)19-7-9-21(25(31)32)23(15-19)27(35)36/h1-12,14-15H,13H2,(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | QUFVUFCYRIDZEY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 217.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |