C22H16O8 — CID 67829919
4-[4-carboxy-4-(3-carboxyphenyl)cyclohexa-1,5-dien-1-yl]phthalic acid (PubChem CID 67829919) has the molecular formula C22H16O8 and a molecular weight of 408.36 g/mol. Its IUPAC name is 4-[4-carboxy-4-(3-carboxyphenyl)cyclohexa-1,5-dien-1-yl]phthalic acid.
| Compound Name | 4-[4-carboxy-4-(3-carboxyphenyl)cyclohexa-1,5-dien-1-yl]phthalic acid |
|---|---|
| PubChem CID | 67829919 |
| Molecular Formula | C22H16O8 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 4-[4-carboxy-4-(3-carboxyphenyl)cyclohexa-1,5-dien-1-yl]phthalic acid |
| SMILES | O=C(O)c1cccc(C2(C(=O)O)C=CC(c3ccc(C(=O)O)c(C(=O)O)c3)=CC2)c1 |
| InChI | InChI=1S/C22H16O8/c23-18(24)14-2-1-3-15(10-14)22(21(29)30)8-6-12(7-9-22)13-4-5-16(19(25)26)17(11-13)20(27)28/h1-8,10-11H,9H2,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | NBAIYIUKPNCZPA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |