C16H12O8 — CID 141377899
2-(1,5-dicarboxycyclohexa-2,4-dien-1-yl)benzene-1,3-dicarboxylic acid (PubChem CID 141377899) has the molecular formula C16H12O8 and a molecular weight of 332.26 g/mol. Its IUPAC name is 2-(1,5-dicarboxycyclohexa-2,4-dien-1-yl)benzene-1,3-dicarboxylic acid.
| Compound Name | 2-(1,5-dicarboxycyclohexa-2,4-dien-1-yl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141377899 |
| Molecular Formula | C16H12O8 |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-(1,5-dicarboxycyclohexa-2,4-dien-1-yl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1=CC=CC(C(=O)O)(c2c(C(=O)O)cccc2C(=O)O)C1 |
| InChI | InChI=1S/C16H12O8/c17-12(18)8-3-2-6-16(7-8,15(23)24)11-9(13(19)20)4-1-5-10(11)14(21)22/h1-6H,7H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | QFGINHBQXAHQAG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |