C15H14O5 — CID 22679065
1-phenylmethoxycyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 22679065) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 1-phenylmethoxycyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-phenylmethoxycyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22679065 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-phenylmethoxycyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1=CC=CC(OCc2ccccc2)(C(=O)O)C1 |
| InChI | InChI=1S/C15H14O5/c16-13(17)12-7-4-8-15(9-12,14(18)19)20-10-11-5-2-1-3-6-11/h1-8H,9-10H2,(H,16,17)(H,18,19) |
| InChIKey | GCVSKDPNSLZXLH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |