C20H22N2O7 — CID 174440117
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-(phenylmethoxymethyl)imidazolidine-2,4-dione (PubChem CID 174440117) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-(phenylmethoxymethyl)imidazolidine-2,4-dione.
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-(phenylmethoxymethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174440117 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-(phenylmethoxymethyl)imidazolidine-2,4-dione |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.O=C1CN(COCc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C11H12N2O3.C9H10O4/c14-10-6-13(11(15)12-10)8-16-7-9-4-2-1-3-5-9;1-9(8(12)13)4-2-3-6(5-9)7(10)11/h1-5H,6-8H2,(H,12,14,15);2-4H,5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | NUVCNLVYUYOVSY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|