C15H15O5P — CID 174494063
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;phosphorosobenzene (PubChem CID 174494063) has the molecular formula C15H15O5P and a molecular weight of 306.25 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;phosphorosobenzene.
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;phosphorosobenzene |
|---|---|
| PubChem CID | 174494063 |
| Molecular Formula | C15H15O5P |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;phosphorosobenzene |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.O=Pc1ccccc1 |
| InChI | InChI=1S/C9H10O4.C6H5OP/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;7-8-6-4-2-1-3-5-6/h2-4H,5H2,1H3,(H,10,11)(H,12,13);1-5H |
| InChIKey | HTMNKIAJSPOTRF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|