C11H15NO6S2 — CID 175313602
carbamodithioic acid;formic acid;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 175313602) has the molecular formula C11H15NO6S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is carbamodithioic acid;formic acid;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | carbamodithioic acid;formic acid;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175313602 |
| Molecular Formula | C11H15NO6S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | carbamodithioic acid;formic acid;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.NC(=S)S.O=CO |
| InChI | InChI=1S/C9H10O4.CH3NS2.CH2O2/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;2-1(3)4;2-1-3/h2-4H,5H2,1H3,(H,10,11)(H,12,13);(H3,2,3,4);1H,(H,2,3) |
| InChIKey | GDUHATGPHCEFQO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|