C16H26O4 — CID 161283855
heptane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 161283855) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is heptane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | heptane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 161283855 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | heptane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCCCCCC |
| InChI | InChI=1S/C9H10O4.C7H16/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-3-5-7-6-4-2/h2-4H,5H2,1H3,(H,10,11)(H,12,13);3-7H2,1-2H3 |
| InChIKey | VFLLHEFWQZZUSV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|