C21H29NO5 — CID 174748475
3-heptyl-1H-pyridin-2-one;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174748475) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-heptyl-1H-pyridin-2-one;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 3-heptyl-1H-pyridin-2-one;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174748475 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3-heptyl-1H-pyridin-2-one;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCCCCCCc1ccc[nH]c1=O |
| InChI | InChI=1S/C12H19NO.C9H10O4/c1-2-3-4-5-6-8-11-9-7-10-13-12(11)14;1-9(8(12)13)4-2-3-6(5-9)7(10)11/h7,9-10H,2-6,8H2,1H3,(H,13,14);2-4H,5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | UVOCERCUDVCVTN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|