C15H22O5 — CID 174772432
1-ethenoxybutane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174772432) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-ethenoxybutane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-ethenoxybutane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174772432 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-ethenoxybutane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | C=COCCCC.CC1(C(=O)O)C=CC=C(C(=O)O)C1 |
| InChI | InChI=1S/C9H10O4.C6H12O/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-3-5-6-7-4-2/h2-4H,5H2,1H3,(H,10,11)(H,12,13);4H,2-3,5-6H2,1H3 |
| InChIKey | NCQQCXUCKCAGBX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|