C20H28O6 — CID 161154462
(1-methylcycloheptyl) prop-2-enoate;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 161154462) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (1-methylcycloheptyl) prop-2-enoate;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | (1-methylcycloheptyl) prop-2-enoate;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 161154462 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (1-methylcycloheptyl) prop-2-enoate;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | C=CC(=O)OC1(C)CCCCCC1.CC1(C(=O)O)C=CC=C(C(=O)O)C1 |
| InChI | InChI=1S/C11H18O2.C9H10O4/c1-3-10(12)13-11(2)8-6-4-5-7-9-11;1-9(8(12)13)4-2-3-6(5-9)7(10)11/h3H,1,4-9H2,2H3;2-4H,5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | UPCMXVADGZUWOM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|