C12H14O8 — CID 174260339
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propanedioic acid (PubChem CID 174260339) has the molecular formula C12H14O8 and a molecular weight of 286.24 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propanedioic acid.
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propanedioic acid |
|---|---|
| PubChem CID | 174260339 |
| Molecular Formula | C12H14O8 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;propanedioic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C9H10O4.C3H4O4/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;4-2(5)1-3(6)7/h2-4H,5H2,1H3,(H,10,11)(H,12,13);1H2,(H,4,5)(H,6,7) |
| InChIKey | KVHOGXLFEJWKTK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|