C9H11F6O4P — CID 157267381
hydron;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;hexafluorophosphate (PubChem CID 157267381) has the molecular formula C9H11F6O4P and a molecular weight of 328.15 g/mol. Its IUPAC name is hydron;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;hexafluorophosphate.
| Compound Name | hydron;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;hexafluorophosphate |
|---|---|
| PubChem CID | 157267381 |
| Molecular Formula | C9H11F6O4P |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | hydron;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;hexafluorophosphate |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.F[P-](F)(F)(F)(F)F.[H+] |
| InChI | InChI=1S/C9H10O4.F6P/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-7(2,3,4,5)6/h2-4H,5H2,1H3,(H,10,11)(H,12,13);/q;-1/p+1 |
| InChIKey | RKIJJZGTJAZBSI-UHFFFAOYSA-O |
| XLogP | 4.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|