C13H20O5 — CID 157389006
butan-1-ol;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 157389006) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is butan-1-ol;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | butan-1-ol;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 157389006 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | butan-1-ol;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCCCO |
| InChI | InChI=1S/C9H10O4.C4H10O/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-3-4-5/h2-4H,5H2,1H3,(H,10,11)(H,12,13);5H,2-4H2,1H3 |
| InChIKey | KDPMIBMNNGCWTF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |