C17H28O5 — CID 161038565
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;octan-1-ol (PubChem CID 161038565) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;octan-1-ol.
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;octan-1-ol |
|---|---|
| PubChem CID | 161038565 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;octan-1-ol |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCCCCCCCO |
| InChI | InChI=1S/C9H10O4.C8H18O/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-3-4-5-6-7-8-9/h2-4H,5H2,1H3,(H,10,11)(H,12,13);9H,2-8H2,1H3 |
| InChIKey | UAORXBYOFOJNPX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|