C21H26O5 — CID 174747491
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-phenylcyclohexan-1-ol (PubChem CID 174747491) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-phenylcyclohexan-1-ol.
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 174747491 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-phenylcyclohexan-1-ol |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.OC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C12H16O.C9H10O4/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11;1-9(8(12)13)4-2-3-6(5-9)7(10)11/h1,3-4,7-8,13H,2,5-6,9-10H2;2-4H,5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | PGLFTLFOEPKGOS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |