C20H22NO4P — CID 174555877
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;phenylphosphane;pyridine (PubChem CID 174555877) has the molecular formula C20H22NO4P and a molecular weight of 371.37 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;phenylphosphane;pyridine.
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;phenylphosphane;pyridine |
|---|---|
| PubChem CID | 174555877 |
| Molecular Formula | C20H22NO4P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;phenylphosphane;pyridine |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.Pc1ccccc1.c1ccncc1 |
| InChI | InChI=1S/C9H10O4.C6H7P.C5H5N/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;7-6-4-2-1-3-5-6;1-2-4-6-5-3-1/h2-4H,5H2,1H3,(H,10,11)(H,12,13);1-5H,7H2;1-5H |
| InChIKey | WVETTYOORGINLC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|