C8H7NO6 — CID 18429280
1-nitrocyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 18429280) has the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. Its IUPAC name is 1-nitrocyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-nitrocyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 18429280 |
| Molecular Formula | C8H7NO6 |
| Molecular Weight | 213.14 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | 1-nitrocyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1=CC=CC(C(=O)O)([N+](=O)[O-])C1 |
| InChI | InChI=1S/C8H7NO6/c10-6(11)5-2-1-3-8(4-5,7(12)13)9(14)15/h1-3H,4H2,(H,10,11)(H,12,13) |
| InChIKey | KSPPWGQIGVSIRK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|