C20H17NO4 — CID 141457980
4-[4-amino-4-(4-carboxyphenyl)cyclohexa-1,5-dien-1-yl]benzoic acid (PubChem CID 141457980) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-[4-amino-4-(4-carboxyphenyl)cyclohexa-1,5-dien-1-yl]benzoic acid.
| Compound Name | 4-[4-amino-4-(4-carboxyphenyl)cyclohexa-1,5-dien-1-yl]benzoic acid |
|---|---|
| PubChem CID | 141457980 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-[4-amino-4-(4-carboxyphenyl)cyclohexa-1,5-dien-1-yl]benzoic acid |
| SMILES | NC1(c2ccc(C(=O)O)cc2)C=CC(c2ccc(C(=O)O)cc2)=CC1 |
| InChI | InChI=1S/C20H17NO4/c21-20(17-7-5-16(6-8-17)19(24)25)11-9-14(10-12-20)13-1-3-15(4-2-13)18(22)23/h1-11H,12,21H2,(H,22,23)(H,24,25) |
| InChIKey | LKEWOVDPYGQUGL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |