C24H22N2 — CID 70010989
4-[1-(4-aminophenyl)-4-phenylcyclohexa-2,4-dien-1-yl]aniline (PubChem CID 70010989) has the molecular formula C24H22N2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[1-(4-aminophenyl)-4-phenylcyclohexa-2,4-dien-1-yl]aniline.
| Compound Name | 4-[1-(4-aminophenyl)-4-phenylcyclohexa-2,4-dien-1-yl]aniline |
|---|---|
| PubChem CID | 70010989 |
| Molecular Formula | C24H22N2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 4-[1-(4-aminophenyl)-4-phenylcyclohexa-2,4-dien-1-yl]aniline |
| SMILES | Nc1ccc(C2(c3ccc(N)cc3)C=CC(c3ccccc3)=CC2)cc1 |
| InChI | InChI=1S/C24H22N2/c25-22-10-6-20(7-11-22)24(21-8-12-23(26)13-9-21)16-14-19(15-17-24)18-4-2-1-3-5-18/h1-16H,17,25-26H2 |
| InChIKey | CLOSIBMLQGWHEI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|