C12H14ClFN2 — CID 172857422
4-(4-amino-4-fluorocyclohexa-1,5-dien-1-yl)aniline;hydrochloride (PubChem CID 172857422) has the molecular formula C12H14ClFN2 and a molecular weight of 240.71 g/mol. Its IUPAC name is 4-(4-amino-4-fluorocyclohexa-1,5-dien-1-yl)aniline;hydrochloride.
| Compound Name | 4-(4-amino-4-fluorocyclohexa-1,5-dien-1-yl)aniline;hydrochloride |
|---|---|
| PubChem CID | 172857422 |
| Molecular Formula | C12H14ClFN2 |
| Molecular Weight | 240.71 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 4-(4-amino-4-fluorocyclohexa-1,5-dien-1-yl)aniline;hydrochloride |
| SMILES | Cl.Nc1ccc(C2=CCC(N)(F)C=C2)cc1 |
| InChI | InChI=1S/C12H13FN2.ClH/c13-12(15)7-5-10(6-8-12)9-1-3-11(14)4-2-9;/h1-7H,8,14-15H2;1H |
| InChIKey | YXBDMZROXCLDOW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|